C40H50N2O5 — CID 6684465
prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 6684465) has the molecular formula C40H50N2O5 and a molecular weight of 638.85 g/mol. Its IUPAC name is prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6684465 |
| Molecular Formula | C40H50N2O5 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CN3CC4(C)CC3CC(C)(C)C4)[C@H](C)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C40H50N2O5/c1-6-19-45-38(44)41-22-32-9-7-8-10-34(32)29-15-17-31(18-16-29)37-46-35(23-42-26-40(5)21-33(42)20-39(3,4)25-40)27(2)36(47-37)30-13-11-28(24-43)12-14-30/h6-18,27,33,35-37,43H,1,19-26H2,2-5H3,(H,41,44)/t27-,33?,35+,36+,37+,40?/m0/s1 |
| InChIKey | CNLUPQGZCMAJTK-RROJFIAFSA-N |
| XLogP | 7.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|