C42H46N4O6 — CID 6686762
prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 6686762) has the molecular formula C42H46N4O6 and a molecular weight of 702.85 g/mol. Its IUPAC name is prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6686762 |
| Molecular Formula | C42H46N4O6 |
| Molecular Weight | 702.85 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | prop-2-enyl N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CN3CCC(n4c(=O)[nH]c5ccccc54)CC3)[C@H](C)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C42H46N4O6/c1-3-24-50-42(49)43-25-33-8-4-5-9-35(33)30-16-18-32(19-17-30)40-51-38(28(2)39(52-40)31-14-12-29(27-47)13-15-31)26-45-22-20-34(21-23-45)46-37-11-7-6-10-36(37)44-41(46)48/h3-19,28,34,38-40,47H,1,20-27H2,2H3,(H,43,49)(H,44,48)/t28-,38+,39+,40+/m0/s1 |
| InChIKey | LTBHCJQIOURWOH-WFWPXIHJSA-N |
| XLogP | 7.03 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.85 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|