C31H39Cl3N2O4 — CID 4546910
2,2,2-trichloro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 4546910) has the molecular formula C31H39Cl3N2O4 and a molecular weight of 610.02 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4546910 |
| Molecular Formula | C31H39Cl3N2O4 |
| Molecular Weight | 610.02 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | CC1C(CN2CC3(C)CC2CC(C)(C)C3)OC(c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C31H39Cl3N2O4/c1-19-25(15-36-18-30(4)14-24(36)13-29(2,3)17-30)39-27(40-26(19)21-10-8-20(16-37)9-11-21)22-6-5-7-23(12-22)35-28(38)31(32,33)34/h5-12,19,24-27,37H,13-18H2,1-4H3,(H,35,38) |
| InChIKey | FNQOOOXXSBBGOR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.02 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|