C23H25F3N2O2 — CID 66882605
3-(furan-2-yl)-4-methyl-N-pentyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide (PubChem CID 66882605) has the molecular formula C23H25F3N2O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-methyl-N-pentyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide.
| Compound Name | 3-(furan-2-yl)-4-methyl-N-pentyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66882605 |
| Molecular Formula | C23H25F3N2O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-(furan-2-yl)-4-methyl-N-pentyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide |
| SMILES | CCCCCNC(=O)c1c(-c2ccco2)c(C)cn1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H25F3N2O2/c1-3-4-5-12-27-22(29)21-20(19-7-6-13-30-19)16(2)14-28(21)15-17-8-10-18(11-9-17)23(24,25)26/h6-11,13-14H,3-5,12,15H2,1-2H3,(H,27,29) |
| InChIKey | NNGPQHJFJZCEPD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|