C20H20F3N3O2 — CID 46087835
N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]hexanamide (PubChem CID 46087835) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]hexanamide.
| Compound Name | N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 46087835 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cc(-c2ccco2)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3N3O2/c1-2-3-4-7-19(27)24-18-13-16(17-6-5-12-28-17)25-26(18)15-10-8-14(9-11-15)20(21,22)23/h5-6,8-13H,2-4,7H2,1H3,(H,24,27) |
| InChIKey | CIPFFLCVQAMHGP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|