C24H20F3N3O3 — CID 83278592
N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]-4-phenoxybutanamide (PubChem CID 83278592) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]-4-phenoxybutanamide.
| Compound Name | N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 83278592 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[3-(furan-2-yl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-yl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1cc(-c2ccco2)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F3N3O3/c25-24(26,27)17-10-12-18(13-11-17)30-22(16-20(29-30)21-8-4-15-33-21)28-23(31)9-5-14-32-19-6-2-1-3-7-19/h1-4,6-8,10-13,15-16H,5,9,14H2,(H,28,31) |
| InChIKey | MKNIXRKFFNSMTK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|