C21H20N2O4 — CID 30907632
N-[4-(4-phenoxybutanoylamino)phenyl]furan-2-carboxamide (PubChem CID 30907632) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[4-(4-phenoxybutanoylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(4-phenoxybutanoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30907632 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[4-(4-phenoxybutanoylamino)phenyl]furan-2-carboxamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c24-20(9-5-14-26-18-6-2-1-3-7-18)22-16-10-12-17(13-11-16)23-21(25)19-8-4-15-27-19/h1-4,6-8,10-13,15H,5,9,14H2,(H,22,24)(H,23,25) |
| InChIKey | RXVCVGNCDYTLAH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|