C19H19ClFN3O — CID 66884636
4-[(3-chloro-4-fluorophenyl)methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide (PubChem CID 66884636) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 66884636 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2cccnc2)CCC1=Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClFN3O/c1-13-12-24(19(25)23-16-3-2-7-22-11-16)8-6-15(13)9-14-4-5-18(21)17(20)10-14/h2-5,7,9-11,13H,6,8,12H2,1H3,(H,23,25) |
| InChIKey | QUKXMJDWHTULSA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |