C26H31N3O2 — CID 67229064
(4E)-4-[[3-(cyclohex-3-en-1-ylmethoxy)phenyl]methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide (PubChem CID 67229064) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (4E)-4-[[3-(cyclohex-3-en-1-ylmethoxy)phenyl]methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide.
| Compound Name | (4E)-4-[[3-(cyclohex-3-en-1-ylmethoxy)phenyl]methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 67229064 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (4E)-4-[[3-(cyclohex-3-en-1-ylmethoxy)phenyl]methylidene]-3-methyl-N-pyridin-3-ylpiperidine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2cccnc2)CC/C1=C\c1cccc(OCC2CC=CCC2)c1 |
| InChI | InChI=1S/C26H31N3O2/c1-20-18-29(26(30)28-24-10-6-13-27-17-24)14-12-23(20)15-22-9-5-11-25(16-22)31-19-21-7-3-2-4-8-21/h2-3,5-6,9-11,13,15-17,20-21H,4,7-8,12,14,18-19H2,1H3,(H,28,30)/b23-15+ |
| InChIKey | AZUFQEPCVJYVEG-HZHRSRAPSA-N |
| XLogP | 5.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|