C19H14N6O — CID 66887159
4-(2-methoxy-3-pyridinyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene (PubChem CID 66887159) has the molecular formula C19H14N6O and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-(2-methoxy-3-pyridinyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene.
| Compound Name | 4-(2-methoxy-3-pyridinyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene |
|---|---|
| PubChem CID | 66887159 |
| Molecular Formula | C19H14N6O |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-(2-methoxy-3-pyridinyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene |
| SMILES | COc1ncccc1-c1nc2c([nH]1)-c1ccncc1Nc1ncccc1-2 |
| InChI | InChI=1S/C19H14N6O/c1-26-19-13(5-3-8-22-19)18-24-15-11-6-9-20-10-14(11)23-17-12(16(15)25-18)4-2-7-21-17/h2-10H,1H3,(H,21,23)(H,24,25) |
| InChIKey | BLPJDCVESVXEQZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |