C17H17N5 — CID 58901618
4-butyl-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene (PubChem CID 58901618) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-butyl-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene.
| Compound Name | 4-butyl-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene |
|---|---|
| PubChem CID | 58901618 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-butyl-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene |
| SMILES | CCCCc1nc2c([nH]1)-c1ccncc1Nc1ncccc1-2 |
| InChI | InChI=1S/C17H17N5/c1-2-3-6-14-21-15-11-7-9-18-10-13(11)20-17-12(16(15)22-14)5-4-8-19-17/h4-5,7-10H,2-3,6H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | VSCNMSVOWCUILK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |