C17H15FN4OS — CID 66886691
16-fluoro-4-(2-methylsulfinylethyl)-3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7(12),8,10,15,17-octaene (PubChem CID 66886691) has the molecular formula C17H15FN4OS and a molecular weight of 342.40 g/mol. Its IUPAC name is 16-fluoro-4-(2-methylsulfinylethyl)-3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7(12),8,10,15,17-octaene.
| Compound Name | 16-fluoro-4-(2-methylsulfinylethyl)-3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7(12),8,10,15,17-octaene |
|---|---|
| PubChem CID | 66886691 |
| Molecular Formula | C17H15FN4OS |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 16-fluoro-4-(2-methylsulfinylethyl)-3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7(12),8,10,15,17-octaene |
| SMILES | CS(=O)CCc1nc2c([nH]1)-c1ccc(F)cc1Nc1ncccc1-2 |
| InChI | InChI=1S/C17H15FN4OS/c1-24(23)8-6-14-21-15-11-5-4-10(18)9-13(11)20-17-12(16(15)22-14)3-2-7-19-17/h2-5,7,9H,6,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QGIFZLSQYHOVRS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |