C17H19BrFN3O — CID 66888537
N-[(3-bromo-4-fluorophenyl)methyl]-N-cyclopentyl-1-methylimidazole-4-carboxamide (PubChem CID 66888537) has the molecular formula C17H19BrFN3O and a molecular weight of 380.26 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-N-cyclopentyl-1-methylimidazole-4-carboxamide.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-N-cyclopentyl-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 66888537 |
| Molecular Formula | C17H19BrFN3O |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-N-cyclopentyl-1-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C(=O)N(Cc2ccc(F)c(Br)c2)C2CCCC2)c1 |
| InChI | InChI=1S/C17H19BrFN3O/c1-21-10-16(20-11-21)17(23)22(13-4-2-3-5-13)9-12-6-7-15(19)14(18)8-12/h6-8,10-11,13H,2-5,9H2,1H3 |
| InChIKey | HXLVCRCKHFYIIN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |