C16H19BrFN3O — CID 66888857
N-[(3-bromo-4-fluorophenyl)methyl]-1-methyl-N-(2-methylpropyl)imidazole-4-carboxamide (PubChem CID 66888857) has the molecular formula C16H19BrFN3O and a molecular weight of 368.25 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-1-methyl-N-(2-methylpropyl)imidazole-4-carboxamide.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-1-methyl-N-(2-methylpropyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 66888857 |
| Molecular Formula | C16H19BrFN3O |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-1-methyl-N-(2-methylpropyl)imidazole-4-carboxamide |
| SMILES | CC(C)CN(Cc1ccc(F)c(Br)c1)C(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C16H19BrFN3O/c1-11(2)7-21(16(22)15-9-20(3)10-19-15)8-12-4-5-14(18)13(17)6-12/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | HLJLTROPMFDLSF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |