C21H22F6N4O — CID 87145442
N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]methyl]-1-methylimidazole-4-carboxamide (PubChem CID 87145442) has the molecular formula C21H22F6N4O and a molecular weight of 460.42 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]methyl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]methyl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 87145442 |
| Molecular Formula | C21H22F6N4O |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[[3-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]methyl]-1-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C(=O)N(Cc2cccc(C(C(F)(F)F)C(F)(F)F)c2)CC2C3CNCC32)c1 |
| InChI | InChI=1S/C21H22F6N4O/c1-30-10-17(29-11-30)19(32)31(9-16-14-6-28-7-15(14)16)8-12-3-2-4-13(5-12)18(20(22,23)24)21(25,26)27/h2-5,10-11,14-16,18,28H,6-9H2,1H3 |
| InChIKey | ALRUNSDWRZERDW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |