C14H13FN2O6 — CID 66893557
(3S,4R)-3-fluoro-4-[(5-nitro-1-benzofuran-7-yl)oxy]piperidine-1-carboxylic acid (PubChem CID 66893557) has the molecular formula C14H13FN2O6 and a molecular weight of 324.26 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-4-[(5-nitro-1-benzofuran-7-yl)oxy]piperidine-1-carboxylic acid.
| Compound Name | (3S,4R)-3-fluoro-4-[(5-nitro-1-benzofuran-7-yl)oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66893557 |
| Molecular Formula | C14H13FN2O6 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (3S,4R)-3-fluoro-4-[(5-nitro-1-benzofuran-7-yl)oxy]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@H](Oc2cc([N+](=O)[O-])cc3ccoc23)[C@@H](F)C1 |
| InChI | InChI=1S/C14H13FN2O6/c15-10-7-16(14(18)19)3-1-11(10)23-12-6-9(17(20)21)5-8-2-4-22-13(8)12/h2,4-6,10-11H,1,3,7H2,(H,18,19)/t10-,11+/m0/s1 |
| InChIKey | OIXZIQMGINBJRH-WDEREUQCSA-N |
| XLogP | 2.81 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|