C9H16O2 — CID 66897009
(3S,4R)-4-pent-4-enyloxolan-3-ol (PubChem CID 66897009) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (3S,4R)-4-pent-4-enyloxolan-3-ol.
| Compound Name | (3S,4R)-4-pent-4-enyloxolan-3-ol |
|---|---|
| PubChem CID | 66897009 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3S,4R)-4-pent-4-enyloxolan-3-ol |
| SMILES | C=CCCC[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-8-6-11-7-9(8)10/h2,8-10H,1,3-7H2/t8-,9-/m1/s1 |
| InChIKey | ABZCXRWPERHSHQ-RKDXNWHRSA-N |
| XLogP | 1.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|