About CID 66898035
CID 66898035 (PubChem CID 66898035) has the molecular formula C14H10Al2CaN2O6
and a molecular weight of 396.28 g/mol.
Molecular Properties
| Compound Name | CID 66898035 |
| PubChem CID | 66898035 |
| Molecular Formula | C14H10Al2CaN2O6 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | — |
| SMILES | Nc1ccc(C(=O)[O-])c(O[Al])c1.Nc1ccc(C(=O)[O-])c(O[Al])c1.[Ca+2] |
| InChI | InChI=1S/2C7H7NO3.2Al.Ca/c2*8-4-1-2-5(7(10)11)6(9)3-4;;;/h2*1-3,9H,8H2,(H,10,11);;;/q;;2*+1;+2/p-4 |
| InChIKey | VZFGFZLJDIPHCQ-UHFFFAOYSA-J |
| XLogP | -2.19 |
| TPSA | 150.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze CID 66898035 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66898035?
The IUPAC name of CID 66898035 (CID 66898035) is not available.
What is the SMILES notation for CID 66898035?
The canonical SMILES for CID 66898035 is Nc1ccc(C(=O)[O-])c(O[Al])c1.Nc1ccc(C(=O)[O-])c(O[Al])c1.[Ca+2].
What is the InChIKey of CID 66898035?
The InChIKey is VZFGFZLJDIPHCQ-UHFFFAOYSA-J. The full InChI is InChI=1S/2C7H7NO3.2Al.Ca/c2*8-4-1-2-5(7(10)11)6(9)3-4;;;/h2*1-3,9H,8H2,(H,10,11);;;/q;;2*+1;+2/p-4.
What are the key properties of CID 66898035?
CID 66898035 has a molecular weight of 396.28 g/mol, XLogP of -2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66898035 is sourced from PubChem (CID 66898035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).