C17H22N4O2 — CID 66899432
1-[1-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]indazole-7-carboxylic acid (PubChem CID 66899432) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[1-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]indazole-7-carboxylic acid.
| Compound Name | 1-[1-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 66899432 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[1-(1-azabicyclo[2.2.2]octan-3-ylamino)ethyl]indazole-7-carboxylic acid |
| SMILES | CC(NC1CN2CCC1CC2)n1ncc2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C17H22N4O2/c1-11(19-15-10-20-7-5-12(15)6-8-20)21-16-13(9-18-21)3-2-4-14(16)17(22)23/h2-4,9,11-12,15,19H,5-8,10H2,1H3,(H,22,23) |
| InChIKey | XXSJSJZINOIUFK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |