C26H33N3O6S — CID 66902085
3-[(4-tert-butylphenyl)methyl]-8-[(2-methyl-5-nitrophenyl)methylsulfonyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 66902085) has the molecular formula C26H33N3O6S and a molecular weight of 515.63 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methyl]-8-[(2-methyl-5-nitrophenyl)methylsulfonyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 3-[(4-tert-butylphenyl)methyl]-8-[(2-methyl-5-nitrophenyl)methylsulfonyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 66902085 |
| Molecular Formula | C26H33N3O6S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methyl]-8-[(2-methyl-5-nitrophenyl)methylsulfonyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | Cc1ccc([N+](=O)[O-])cc1CS(=O)(=O)N1CCC2(CC1)CN(Cc1ccc(C(C)(C)C)cc1)C(=O)O2 |
| InChI | InChI=1S/C26H33N3O6S/c1-19-5-10-23(29(31)32)15-21(19)17-36(33,34)28-13-11-26(12-14-28)18-27(24(30)35-26)16-20-6-8-22(9-7-20)25(2,3)4/h5-10,15H,11-14,16-18H2,1-4H3 |
| InChIKey | FPGCRKJOIYMZDK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|