C21H33N5O2 — CID 66903579
2-[2-[[4-(azocan-1-yl)quinazolin-2-yl]amino]ethyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 66903579) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[2-[[4-(azocan-1-yl)quinazolin-2-yl]amino]ethyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[2-[[4-(azocan-1-yl)quinazolin-2-yl]amino]ethyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 66903579 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 2-[2-[[4-(azocan-1-yl)quinazolin-2-yl]amino]ethyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)CCNc1nc(N2CCCCCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C21H33N5O2/c27-16-14-25(15-17-28)13-10-22-21-23-19-9-5-4-8-18(19)20(24-21)26-11-6-2-1-3-7-12-26/h4-5,8-9,27-28H,1-3,6-7,10-17H2,(H,22,23,24) |
| InChIKey | OEVBJCRRXQBHGS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |