C8H5ClFN3O2S2 — CID 66905573
5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 66905573) has the molecular formula C8H5ClFN3O2S2 and a molecular weight of 293.73 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 66905573 |
| Molecular Formula | C8H5ClFN3O2S2 |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | 5-chloro-2-fluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C8H5ClFN3O2S2/c9-5-1-2-6(10)7(3-5)17(14,15)13-8-11-4-12-16-8/h1-4H,(H,11,12,13) |
| InChIKey | YUMSZCXQOBFMPF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |