About methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate
methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate (PubChem CID 66905663) has the molecular formula C19H21FN2O3
and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 66905663 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC[C@@H](CO)[C@H](c3ccccc3)C2)c(F)c1 |
| InChI | InChI=1S/C19H21FN2O3/c1-25-19(24)15-9-17(20)18(21-10-15)22-8-7-14(12-23)16(11-22)13-5-3-2-4-6-13/h2-6,9-10,14,16,23H,7-8,11-12H2,1H3/t14-,16-/m0/s1 |
| InChIKey | KOFSIVPQYNDVRY-HOCLYGCPSA-N |
| XLogP | 2.61 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate?
The IUPAC name of methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate (CID 66905663) is methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate is COC(=O)c1cnc(N2CC[C@@H](CO)[C@H](c3ccccc3)C2)c(F)c1.
What is the InChIKey of methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate?
The InChIKey is KOFSIVPQYNDVRY-HOCLYGCPSA-N. The full InChI is InChI=1S/C19H21FN2O3/c1-25-19(24)15-9-17(20)18(21-10-15)22-8-7-14(12-23)16(11-22)13-5-3-2-4-6-13/h2-6,9-10,14,16,23H,7-8,11-12H2,1H3/t14-,16-/m0/s1.
What are the key properties of methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate?
methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate has a molecular weight of 344.39 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-fluoro-6-[(3R,4R)-4-(hydroxymethyl)-3-phenylpiperidin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 66905663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).