C18H23N3O2 — CID 126804917
[(3R,4R)-1-(3-ethoxypyrazin-2-yl)-4-phenylpiperidin-3-yl]methanol (PubChem CID 126804917) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [(3R,4R)-1-(3-ethoxypyrazin-2-yl)-4-phenylpiperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-(3-ethoxypyrazin-2-yl)-4-phenylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 126804917 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [(3R,4R)-1-(3-ethoxypyrazin-2-yl)-4-phenylpiperidin-3-yl]methanol |
| SMILES | CCOc1nccnc1N1CC[C@@H](c2ccccc2)[C@@H](CO)C1 |
| InChI | InChI=1S/C18H23N3O2/c1-2-23-18-17(19-9-10-20-18)21-11-8-16(15(12-21)13-22)14-6-4-3-5-7-14/h3-7,9-10,15-16,22H,2,8,11-13H2,1H3/t15-,16+/m1/s1 |
| InChIKey | OJEPQDYAGJUEHA-CVEARBPZSA-N |
| XLogP | 2.48 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |