C17H21N3O — CID 126810365
[(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol (PubChem CID 126810365) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 126810365 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol |
| SMILES | Cc1ccnc(N2CC[C@@H](c3ccccc3)[C@@H](CO)C2)n1 |
| InChI | InChI=1S/C17H21N3O/c1-13-7-9-18-17(19-13)20-10-8-16(15(11-20)12-21)14-5-3-2-4-6-14/h2-7,9,15-16,21H,8,10-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | KMIVPIHNZXBBRN-CVEARBPZSA-N |
| XLogP | 2.39 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |