About [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol
[(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol (PubChem CID 126810365) has the molecular formula C17H21N3O
and a molecular weight of 283.38 g/mol. Its IUPAC name is [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol |
| PubChem CID | 126810365 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol |
| SMILES | Cc1ccnc(N2CC[C@@H](c3ccccc3)[C@@H](CO)C2)n1 |
| InChI | InChI=1S/C17H21N3O/c1-13-7-9-18-17(19-13)20-10-8-16(15(11-20)12-21)14-5-3-2-4-6-14/h2-7,9,15-16,21H,8,10-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | KMIVPIHNZXBBRN-CVEARBPZSA-N |
| XLogP | 2.39 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol?
The IUPAC name of [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol (CID 126810365) is [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol?
The canonical SMILES for [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol is Cc1ccnc(N2CC[C@@H](c3ccccc3)[C@@H](CO)C2)n1.
What is the InChIKey of [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol?
The InChIKey is KMIVPIHNZXBBRN-CVEARBPZSA-N. The full InChI is InChI=1S/C17H21N3O/c1-13-7-9-18-17(19-13)20-10-8-16(15(11-20)12-21)14-5-3-2-4-6-14/h2-7,9,15-16,21H,8,10-12H2,1H3/t15-,16+/m1/s1.
What are the key properties of [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol?
[(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol has a molecular weight of 283.38 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-1-(4-methylpyrimidin-2-yl)-4-phenylpiperidin-3-yl]methanol is sourced from PubChem (CID 126810365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).