C12H14N4O3 — CID 66914825
(2S)-2-amino-N-(2,5-dioxoimidazolidin-4-yl)-3-phenylpropanamide (PubChem CID 66914825) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,5-dioxoimidazolidin-4-yl)-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-(2,5-dioxoimidazolidin-4-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 66914825 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2S)-2-amino-N-(2,5-dioxoimidazolidin-4-yl)-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NC1NC(=O)NC1=O |
| InChI | InChI=1S/C12H14N4O3/c13-8(6-7-4-2-1-3-5-7)10(17)14-9-11(18)16-12(19)15-9/h1-5,8-9H,6,13H2,(H,14,17)(H2,15,16,18,19)/t8-,9?/m0/s1 |
| InChIKey | KVDYVPCVOHBLKV-IENPIDJESA-N |
| XLogP | -1.16 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|