C35H37ClN2O4 — CID 66916209
ethyl 3-[2-[4-[[2-(4-chlorophenyl)-5-methoxyphenyl]methoxy]phenyl]-1-cyclohexylimidazol-4-yl]-2-methylprop-2-enoate (PubChem CID 66916209) has the molecular formula C35H37ClN2O4 and a molecular weight of 585.14 g/mol. Its IUPAC name is ethyl 3-[2-[4-[[2-(4-chlorophenyl)-5-methoxyphenyl]methoxy]phenyl]-1-cyclohexylimidazol-4-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[2-[4-[[2-(4-chlorophenyl)-5-methoxyphenyl]methoxy]phenyl]-1-cyclohexylimidazol-4-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66916209 |
| Molecular Formula | C35H37ClN2O4 |
| Molecular Weight | 585.14 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | ethyl 3-[2-[4-[[2-(4-chlorophenyl)-5-methoxyphenyl]methoxy]phenyl]-1-cyclohexylimidazol-4-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1cn(C2CCCCC2)c(-c2ccc(OCc3cc(OC)ccc3-c3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C35H37ClN2O4/c1-4-41-35(39)24(2)20-29-22-38(30-8-6-5-7-9-30)34(37-29)26-12-16-31(17-13-26)42-23-27-21-32(40-3)18-19-33(27)25-10-14-28(36)15-11-25/h10-22,30H,4-9,23H2,1-3H3 |
| InChIKey | OLYBYILEOYLWBM-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.14 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|