C32H25F2N5O4 — CID 66917623
N'-(4-fluorophenyl)-2-[3-fluoro-4-[6-(4-phenylmethoxyanilino)pyrimidin-4-yl]oxyphenyl]propanediamide (PubChem CID 66917623) has the molecular formula C32H25F2N5O4 and a molecular weight of 581.58 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-2-[3-fluoro-4-[6-(4-phenylmethoxyanilino)pyrimidin-4-yl]oxyphenyl]propanediamide.
| Compound Name | N'-(4-fluorophenyl)-2-[3-fluoro-4-[6-(4-phenylmethoxyanilino)pyrimidin-4-yl]oxyphenyl]propanediamide |
|---|---|
| PubChem CID | 66917623 |
| Molecular Formula | C32H25F2N5O4 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | N'-(4-fluorophenyl)-2-[3-fluoro-4-[6-(4-phenylmethoxyanilino)pyrimidin-4-yl]oxyphenyl]propanediamide |
| SMILES | NC(=O)C(C(=O)Nc1ccc(F)cc1)c1ccc(Oc2cc(Nc3ccc(OCc4ccccc4)cc3)ncn2)c(F)c1 |
| InChI | InChI=1S/C32H25F2N5O4/c33-22-7-9-24(10-8-22)39-32(41)30(31(35)40)21-6-15-27(26(34)16-21)43-29-17-28(36-19-37-29)38-23-11-13-25(14-12-23)42-18-20-4-2-1-3-5-20/h1-17,19,30H,18H2,(H2,35,40)(H,39,41)(H,36,37,38) |
| InChIKey | RPJLSUSCTNDVTQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|