C11H12N2O3 — CID 66920458
ethyl 7-hydroxy-3-methyl-2H-indazole-5-carboxylate (PubChem CID 66920458) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is ethyl 7-hydroxy-3-methyl-2H-indazole-5-carboxylate.
| Compound Name | ethyl 7-hydroxy-3-methyl-2H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 66920458 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | ethyl 7-hydroxy-3-methyl-2H-indazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(O)c2n[nH]c(C)c2c1 |
| InChI | InChI=1S/C11H12N2O3/c1-3-16-11(15)7-4-8-6(2)12-13-10(8)9(14)5-7/h4-5,14H,3H2,1-2H3,(H,12,13) |
| InChIKey | BGAHIKSYHSNRBA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |