C10H14N4 — CID 66920870
4,6-diamino-2-(2-methylpropyl)pyridine-3-carbonitrile (PubChem CID 66920870) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 4,6-diamino-2-(2-methylpropyl)pyridine-3-carbonitrile.
| Compound Name | 4,6-diamino-2-(2-methylpropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 66920870 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4,6-diamino-2-(2-methylpropyl)pyridine-3-carbonitrile |
| SMILES | CC(C)Cc1nc(N)cc(N)c1C#N |
| InChI | InChI=1S/C10H14N4/c1-6(2)3-9-7(5-11)8(12)4-10(13)14-9/h4,6H,3H2,1-2H3,(H4,12,13,14) |
| InChIKey | NJKRUGHYVVMYQU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |