C19H26ClN3 — CID 66921322
4-N-(7-chloroquinolin-4-yl)-1-N,4-N-diethylcyclohexane-1,4-diamine (PubChem CID 66921322) has the molecular formula C19H26ClN3 and a molecular weight of 331.89 g/mol. Its IUPAC name is 4-N-(7-chloroquinolin-4-yl)-1-N,4-N-diethylcyclohexane-1,4-diamine.
| Compound Name | 4-N-(7-chloroquinolin-4-yl)-1-N,4-N-diethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 66921322 |
| Molecular Formula | C19H26ClN3 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N,4-N-diethylcyclohexane-1,4-diamine |
| SMILES | CCNC1CCC(N(CC)c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C19H26ClN3/c1-3-21-15-6-8-16(9-7-15)23(4-2)19-11-12-22-18-13-14(20)5-10-17(18)19/h5,10-13,15-16,21H,3-4,6-9H2,1-2H3 |
| InChIKey | PZFLUQMYOUWGOL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |