C17H22ClN3O2S — CID 133321245
N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-N-ethylmethanesulfonamide (PubChem CID 133321245) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-N-ethylmethanesulfonamide.
| Compound Name | N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 133321245 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[1-(7-chloroquinolin-4-yl)piperidin-4-yl]-N-ethylmethanesulfonamide |
| SMILES | CCN(C1CCN(c2ccnc3cc(Cl)ccc23)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C17H22ClN3O2S/c1-3-21(24(2,22)23)14-7-10-20(11-8-14)17-6-9-19-16-12-13(18)4-5-15(16)17/h4-6,9,12,14H,3,7-8,10-11H2,1-2H3 |
| InChIKey | SHWMTUDTFDNJLY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |