C15H13F2NO3 — CID 66922005
ethyl 4-[2-(2,4-difluorophenyl)acetyl]-1H-pyrrole-2-carboxylate (PubChem CID 66922005) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is ethyl 4-[2-(2,4-difluorophenyl)acetyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-(2,4-difluorophenyl)acetyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 66922005 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | ethyl 4-[2-(2,4-difluorophenyl)acetyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)Cc2ccc(F)cc2F)c[nH]1 |
| InChI | InChI=1S/C15H13F2NO3/c1-2-21-15(20)13-5-10(8-18-13)14(19)6-9-3-4-11(16)7-12(9)17/h3-5,7-8,18H,2,6H2,1H3 |
| InChIKey | JHDDPYSKHNSXCF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |