About 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine
1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine (PubChem CID 66924833) has the molecular formula C19H18F2N2O3S
and a molecular weight of 392.43 g/mol. Its IUPAC name is 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine |
| PubChem CID | 66924833 |
| Molecular Formula | C19H18F2N2O3S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(-c2ccc(F)cc2F)n(S(=O)(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C19H18F2N2O3S/c1-22-11-13-9-19(17-8-3-14(20)10-18(17)21)23(12-13)27(24,25)16-6-4-15(26-2)5-7-16/h3-10,12,22H,11H2,1-2H3 |
| InChIKey | FVKMOZFYRACSIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine?
The IUPAC name of 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine (CID 66924833) is 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine?
The canonical SMILES for 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine is CNCc1cc(-c2ccc(F)cc2F)n(S(=O)(=O)c2ccc(OC)cc2)c1.
What is the InChIKey of 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine?
The InChIKey is FVKMOZFYRACSIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F2N2O3S/c1-22-11-13-9-19(17-8-3-14(20)10-18(17)21)23(12-13)27(24,25)16-6-4-15(26-2)5-7-16/h3-10,12,22H,11H2,1-2H3.
What are the key properties of 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine?
1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine has a molecular weight of 392.43 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,4-difluorophenyl)-1-(4-methoxyphenyl)sulfonylpyrrol-3-yl]-N-methylmethanamine is sourced from PubChem (CID 66924833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).