C15H19ClN2O2S — CID 66924914
1-[1-(benzenesulfonyl)-5-cyclopropylpyrrol-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 66924914) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-5-cyclopropylpyrrol-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(benzenesulfonyl)-5-cyclopropylpyrrol-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 66924914 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-5-cyclopropylpyrrol-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1cc(C2CC2)n(S(=O)(=O)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C15H18N2O2S.ClH/c1-16-10-12-9-15(13-7-8-13)17(11-12)20(18,19)14-5-3-2-4-6-14;/h2-6,9,11,13,16H,7-8,10H2,1H3;1H |
| InChIKey | VVHRKFGJKUWHNT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |