C18H19ClN2O2S — CID 118728090
1-[5-(benzenesulfonyl)-1-phenylpyrrol-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 118728090) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)-1-phenylpyrrol-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[5-(benzenesulfonyl)-1-phenylpyrrol-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 118728090 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-[5-(benzenesulfonyl)-1-phenylpyrrol-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1cc(S(=O)(=O)c2ccccc2)n(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C18H18N2O2S.ClH/c1-19-13-15-12-18(20(14-15)16-8-4-2-5-9-16)23(21,22)17-10-6-3-7-11-17;/h2-12,14,19H,13H2,1H3;1H |
| InChIKey | KNVOWRDVEMPKHB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |