C26H28F2N2O3 — CID 66925843
1-(2,4-difluorophenyl)-N-(2,2-dimethylpropyl)-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide (PubChem CID 66925843) has the molecular formula C26H28F2N2O3 and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(2,2-dimethylpropyl)-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-N-(2,2-dimethylpropyl)-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66925843 |
| Molecular Formula | C26H28F2N2O3 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(2,2-dimethylpropyl)-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxamide |
| SMILES | COc1cc2c(cc1OC)-c1c(-c3ccc(F)cc3F)cc(C(=O)NCC(C)(C)C)n1CC2 |
| InChI | InChI=1S/C26H28F2N2O3/c1-26(2,3)14-29-25(31)21-12-19(17-7-6-16(27)11-20(17)28)24-18-13-23(33-5)22(32-4)10-15(18)8-9-30(21)24/h6-7,10-13H,8-9,14H2,1-5H3,(H,29,31) |
| InChIKey | GGUMXLJUFPIVRE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |