About ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate
ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate (PubChem CID 66927096) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate |
| PubChem CID | 66927096 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCC2CC=CO2)cc1 |
| InChI | InChI=1S/C15H18O3/c1-2-17-15(16)13-8-5-12(6-9-13)7-10-14-4-3-11-18-14/h3,5-6,8-9,11,14H,2,4,7,10H2,1H3 |
| InChIKey | OHVQVVABFFZECB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate?
The IUPAC name of ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate (CID 66927096) is ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate.
What is the SMILES notation for ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate?
The canonical SMILES for ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate is CCOC(=O)c1ccc(CCC2CC=CO2)cc1.
What is the InChIKey of ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate?
The InChIKey is OHVQVVABFFZECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-2-17-15(16)13-8-5-12(6-9-13)7-10-14-4-3-11-18-14/h3,5-6,8-9,11,14H,2,4,7,10H2,1H3.
What are the key properties of ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate?
ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate has a molecular weight of 246.31 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(2,3-dihydrofuran-2-yl)ethyl]benzoate is sourced from PubChem (CID 66927096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).