C16H18N2O3 — CID 71084285
ethyl 4-[2-(5-amino-4-cyano-2,3-dihydrofuran-3-yl)ethyl]benzoate (PubChem CID 71084285) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl 4-[2-(5-amino-4-cyano-2,3-dihydrofuran-3-yl)ethyl]benzoate.
| Compound Name | ethyl 4-[2-(5-amino-4-cyano-2,3-dihydrofuran-3-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 71084285 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | ethyl 4-[2-(5-amino-4-cyano-2,3-dihydrofuran-3-yl)ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCC2COC(N)=C2C#N)cc1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-20-16(19)12-6-3-11(4-7-12)5-8-13-10-21-15(18)14(13)9-17/h3-4,6-7,13H,2,5,8,10,18H2,1H3 |
| InChIKey | IBTIORURYFUUHY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |