C32H31N3O5 — CID 66933164
3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoic acid (PubChem CID 66933164) has the molecular formula C32H31N3O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66933164 |
| Molecular Formula | C32H31N3O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(NC(=O)C(c2ccc(CN3N=C(c4ccccc4)OCC3=O)cc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C32H31N3O5/c36-28-21-40-32(26-8-2-1-3-9-26)34-35(28)20-23-10-15-25(16-11-23)30(24-6-4-5-7-24)31(39)33-27-17-12-22(13-18-27)14-19-29(37)38/h1-3,8-19,24,30H,4-7,20-21H2,(H,33,39)(H,37,38) |
| InChIKey | FEKDKJAWANTJSE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|