C34H35N3O5 — CID 76657460
ethyl 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoate (PubChem CID 76657460) has the molecular formula C34H35N3O5 and a molecular weight of 565.67 g/mol. Its IUPAC name is ethyl 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76657460 |
| Molecular Formula | C34H35N3O5 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | ethyl 3-[4-[[2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(NC(=O)C(c2ccc(CN3N=C(c4ccccc4)OCC3=O)cc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C34H35N3O5/c1-2-41-31(39)21-16-24-14-19-29(20-15-24)35-33(40)32(26-8-6-7-9-26)27-17-12-25(13-18-27)22-37-30(38)23-42-34(36-37)28-10-4-3-5-11-28/h3-5,10-21,26,32H,2,6-9,22-23H2,1H3,(H,35,40) |
| InChIKey | ZRWSJPKMFANYGG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|