C32H33N3O5 — CID 66933102
(E)-3-[4-[[3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanoyl]amino]phenyl]pent-2-enoic acid (PubChem CID 66933102) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is (E)-3-[4-[[3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanoyl]amino]phenyl]pent-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanoyl]amino]phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 66933102 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (E)-3-[4-[[3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanoyl]amino]phenyl]pent-2-enoic acid |
| SMILES | CC/C(=C\C(=O)O)c1ccc(NC(=O)C(c2ccc(CN3N=C(c4ccccc4)OCC3=O)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C32H33N3O5/c1-4-23(18-29(37)38)24-14-16-27(17-15-24)33-31(39)30(21(2)3)25-12-10-22(11-13-25)19-35-28(36)20-40-32(34-35)26-8-6-5-7-9-26/h5-18,21,30H,4,19-20H2,1-3H3,(H,33,39)(H,37,38)/b23-18+ |
| InChIKey | IDYDOFKDVVBQJR-PTGBLXJZSA-N |
| XLogP | 5.66 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|