C32H31F4N3O6 — CID 68745685
carbonic acid;N-[5-(cyclopropylmethyl)-2-fluorophenyl]-4,4,4-trifluoro-3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanamide (PubChem CID 68745685) has the molecular formula C32H31F4N3O6 and a molecular weight of 629.61 g/mol. Its IUPAC name is carbonic acid;N-[5-(cyclopropylmethyl)-2-fluorophenyl]-4,4,4-trifluoro-3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanamide.
| Compound Name | carbonic acid;N-[5-(cyclopropylmethyl)-2-fluorophenyl]-4,4,4-trifluoro-3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 68745685 |
| Molecular Formula | C32H31F4N3O6 |
| Molecular Weight | 629.61 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | carbonic acid;N-[5-(cyclopropylmethyl)-2-fluorophenyl]-4,4,4-trifluoro-3-methyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]butanamide |
| SMILES | CC(C(C(=O)Nc1cc(CC2CC2)ccc1F)c1ccc(CN2N=C(c3ccccc3)OCC2=O)cc1)C(F)(F)F.O=C(O)O |
| InChI | InChI=1S/C31H29F4N3O3.CH2O3/c1-19(31(33,34)35)28(29(40)36-26-16-22(11-14-25(26)32)15-20-7-8-20)23-12-9-21(10-13-23)17-38-27(39)18-41-30(37-38)24-5-3-2-4-6-24;2-1(3)4/h2-6,9-14,16,19-20,28H,7-8,15,17-18H2,1H3,(H,36,40);(H2,2,3,4) |
| InChIKey | BHYLDEDIBNEORP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.61 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |