C21H19BrN2O7 — CID 66933646
2-(2-bromo-5-nitrophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one (PubChem CID 66933646) has the molecular formula C21H19BrN2O7 and a molecular weight of 491.29 g/mol. Its IUPAC name is 2-(2-bromo-5-nitrophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one.
| Compound Name | 2-(2-bromo-5-nitrophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one |
|---|---|
| PubChem CID | 66933646 |
| Molecular Formula | C21H19BrN2O7 |
| Molecular Weight | 491.29 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 2-(2-bromo-5-nitrophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one |
| SMILES | CN1CC[C@@H](c2c(O)cc(O)c3c(=O)cc(-c4cc([N+](=O)[O-])ccc4Br)oc23)[C@@H]1CO |
| InChI | InChI=1S/C21H19BrN2O7/c1-23-5-4-11(14(23)9-25)19-15(26)7-16(27)20-17(28)8-18(31-21(19)20)12-6-10(24(29)30)2-3-13(12)22/h2-3,6-8,11,14,25-27H,4-5,9H2,1H3/t11-,14+/m1/s1 |
| InChIKey | FPLRFIGCPLRMCT-RISCZKNCSA-N |
| XLogP | 3.32 |
| TPSA | 137.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|