C23H25BrN2O5 — CID 66933619
2-(4-amino-2-bromophenyl)-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one (PubChem CID 66933619) has the molecular formula C23H25BrN2O5 and a molecular weight of 489.37 g/mol. Its IUPAC name is 2-(4-amino-2-bromophenyl)-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one.
| Compound Name | 2-(4-amino-2-bromophenyl)-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 66933619 |
| Molecular Formula | C23H25BrN2O5 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-(4-amino-2-bromophenyl)-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccc(N)cc3Br)oc2c1[C@@H]1CCN(C)[C@H]1CO |
| InChI | InChI=1S/C23H25BrN2O5/c1-26-7-6-14(16(26)11-27)21-19(29-2)10-20(30-3)22-17(28)9-18(31-23(21)22)13-5-4-12(25)8-15(13)24/h4-5,8-10,14,16,27H,6-7,11,25H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | PTVQVCIVVBVMRD-ZBFHGGJFSA-N |
| XLogP | 3.60 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|