C23H23ClN4O4 — CID 10411673
8-[2-(azidomethyl)-1-methylpyrrolidin-3-yl]-2-(2-chlorophenyl)-5,7-dimethoxychromen-4-one (PubChem CID 10411673) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is 8-[2-(azidomethyl)-1-methylpyrrolidin-3-yl]-2-(2-chlorophenyl)-5,7-dimethoxychromen-4-one.
| Compound Name | 8-[2-(azidomethyl)-1-methylpyrrolidin-3-yl]-2-(2-chlorophenyl)-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 10411673 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 8-[2-(azidomethyl)-1-methylpyrrolidin-3-yl]-2-(2-chlorophenyl)-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3Cl)oc2c1C1CCN(C)C1CN=[N+]=[N-] |
| InChI | InChI=1S/C23H23ClN4O4/c1-28-9-8-14(16(28)12-26-27-25)21-19(30-2)11-20(31-3)22-17(29)10-18(32-23(21)22)13-6-4-5-7-15(13)24/h4-7,10-11,14,16H,8-9,12H2,1-3H3 |
| InChIKey | CQDIUJLELZZAKV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|