C23H22ClNO7 — CID 87209347
(1S,2S)-3-[2-(2-chlorophenyl)-5,7-dimethoxy-4-oxochromen-8-yl]-1-methyl-1-oxidopyrrolidin-1-ium-2-carboxylic acid (PubChem CID 87209347) has the molecular formula C23H22ClNO7 and a molecular weight of 459.88 g/mol. Its IUPAC name is (1S,2S)-3-[2-(2-chlorophenyl)-5,7-dimethoxy-4-oxochromen-8-yl]-1-methyl-1-oxidopyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (1S,2S)-3-[2-(2-chlorophenyl)-5,7-dimethoxy-4-oxochromen-8-yl]-1-methyl-1-oxidopyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 87209347 |
| Molecular Formula | C23H22ClNO7 |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (1S,2S)-3-[2-(2-chlorophenyl)-5,7-dimethoxy-4-oxochromen-8-yl]-1-methyl-1-oxidopyrrolidin-1-ium-2-carboxylic acid |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3Cl)oc2c1C1CC[N@+](C)([O-])[C@@H]1C(=O)O |
| InChI | InChI=1S/C23H22ClNO7/c1-25(29)9-8-13(21(25)23(27)28)19-17(30-2)11-18(31-3)20-15(26)10-16(32-22(19)20)12-6-4-5-7-14(12)24/h4-7,10-11,13,21H,8-9H2,1-3H3,(H,27,28)/t13?,21-,25-/m0/s1 |
| InChIKey | RCLVRFOGRYUXGV-ZLUNRTODSA-N |
| XLogP | 4.02 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|