C22H23ClNO5+ — CID 170315549
2-(2-chlorophenyl)-5,7-dihydroxy-8-(3-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)chromen-4-one (PubChem CID 170315549) has the molecular formula C22H23ClNO5+ and a molecular weight of 416.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5,7-dihydroxy-8-(3-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)chromen-4-one.
| Compound Name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-(3-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 170315549 |
| Molecular Formula | C22H23ClNO5+ |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-(3-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)chromen-4-one |
| SMILES | C[N+]1(C)CCC(c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)C(O)C1 |
| InChI | InChI=1S/C22H22ClNO5/c1-24(2)8-7-13(18(28)11-24)20-15(25)9-16(26)21-17(27)10-19(29-22(20)21)12-5-3-4-6-14(12)23/h3-6,9-10,13,18,28H,7-8,11H2,1-2H3,(H-,25,26,27)/p+1 |
| InChIKey | QNESJIAWNLRXBJ-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|