C21H21ClNO8P — CID 159856663
[4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-6-deuterio-1-methylpiperidin-3-yl] dihydrogen phosphate (PubChem CID 159856663) has the molecular formula C21H21ClNO8P and a molecular weight of 482.83 g/mol. Its IUPAC name is [4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-6-deuterio-1-methylpiperidin-3-yl] dihydrogen phosphate.
| Compound Name | [4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-6-deuterio-1-methylpiperidin-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 159856663 |
| Molecular Formula | C21H21ClNO8P |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-6-deuterio-1-methylpiperidin-3-yl] dihydrogen phosphate |
| SMILES | [2H]C1CC(c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)C(OP(=O)(O)O)CN1C |
| InChI | InChI=1S/C21H21ClNO8P/c1-23-7-6-12(18(10-23)31-32(27,28)29)19-14(24)8-15(25)20-16(26)9-17(30-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,18,24-25H,6-7,10H2,1H3,(H2,27,28,29)/i7D |
| InChIKey | NQPQYVJGRPVZDF-WHRKIXHSSA-N |
| XLogP | 3.42 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|