C21H21ClNO7P — CID 138599434
[(3S)-4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-1-methylpiperidin-3-yl] dihydrogen phosphite (PubChem CID 138599434) has the molecular formula C21H21ClNO7P and a molecular weight of 465.83 g/mol. Its IUPAC name is [(3S)-4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-1-methylpiperidin-3-yl] dihydrogen phosphite.
| Compound Name | [(3S)-4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-1-methylpiperidin-3-yl] dihydrogen phosphite |
|---|---|
| PubChem CID | 138599434 |
| Molecular Formula | C21H21ClNO7P |
| Molecular Weight | 465.83 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | [(3S)-4-[2-(2-chlorophenyl)-5,7-dihydroxy-4-oxochromen-8-yl]-1-methylpiperidin-3-yl] dihydrogen phosphite |
| SMILES | CN1CCC(c2c(O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)[C@H](OP(O)O)C1 |
| InChI | InChI=1S/C21H21ClNO7P/c1-23-7-6-12(18(10-23)30-31(27)28)19-14(24)8-15(25)20-16(26)9-17(29-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,18,24-25,27-28H,6-7,10H2,1H3/t12?,18-/m1/s1 |
| InChIKey | DBNHCRLGSYHYRK-VMHBGOFLSA-N |
| XLogP | 3.54 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|